C17H25NO4S — CID 118771801
1-[(3aR,6R,7aS)-6-(2-hydroxyethoxy)-3a-methoxy-3,4,5,6,7,7a-hexahydro-2H-indol-1-yl]-2-thiophen-3-ylethanone (PubChem CID 118771801) has the molecular formula C17H25NO4S and a molecular weight of 339.46 g/mol. Its IUPAC name is 1-[(3aR,6R,7aS)-6-(2-hydroxyethoxy)-3a-methoxy-3,4,5,6,7,7a-hexahydro-2H-indol-1-yl]-2-thiophen-3-ylethanone.
| Compound Name | 1-[(3aR,6R,7aS)-6-(2-hydroxyethoxy)-3a-methoxy-3,4,5,6,7,7a-hexahydro-2H-indol-1-yl]-2-thiophen-3-ylethanone |
|---|---|
| PubChem CID | 118771801 |
| Molecular Formula | C17H25NO4S |
| Molecular Weight | 339.46 g/mol |
| Exact Mass | 339.15 |
| IUPAC Name | 1-[(3aR,6R,7aS)-6-(2-hydroxyethoxy)-3a-methoxy-3,4,5,6,7,7a-hexahydro-2H-indol-1-yl]-2-thiophen-3-ylethanone |
| SMILES | CO[C@@]12CC[C@@H](OCCO)C[C@@H]1N(C(=O)Cc1ccsc1)CC2 |
| InChI | InChI=1S/C17H25NO4S/c1-21-17-4-2-14(22-8-7-19)11-15(17)18(6-5-17)16(20)10-13-3-9-23-12-13/h3,9,12,14-15,19H,2,4-8,10-11H2,1H3/t14-,15+,17-/m1/s1 |
| InChIKey | CTGVAOXMYHKSGW-HLLBOEOZSA-N |
| XLogP | 1.84 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.46 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |