C16H25N3O5 — CID 118770629
6-[[(3aR,6S,7aS)-6-(2-hydroxyethoxy)-3a-methoxy-3,4,5,6,7,7a-hexahydro-2H-indol-1-yl]methyl]-1H-pyrimidine-2,4-dione (PubChem CID 118770629) has the molecular formula C16H25N3O5 and a molecular weight of 339.39 g/mol. Its IUPAC name is 6-[[(3aR,6S,7aS)-6-(2-hydroxyethoxy)-3a-methoxy-3,4,5,6,7,7a-hexahydro-2H-indol-1-yl]methyl]-1H-pyrimidine-2,4-dione.
| Compound Name | 6-[[(3aR,6S,7aS)-6-(2-hydroxyethoxy)-3a-methoxy-3,4,5,6,7,7a-hexahydro-2H-indol-1-yl]methyl]-1H-pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 118770629 |
| Molecular Formula | C16H25N3O5 |
| Molecular Weight | 339.39 g/mol |
| Exact Mass | 339.18 |
| IUPAC Name | 6-[[(3aR,6S,7aS)-6-(2-hydroxyethoxy)-3a-methoxy-3,4,5,6,7,7a-hexahydro-2H-indol-1-yl]methyl]-1H-pyrimidine-2,4-dione |
| SMILES | CO[C@@]12CC[C@H](OCCO)C[C@@H]1N(Cc1cc(=O)[nH]c(=O)[nH]1)CC2 |
| InChI | InChI=1S/C16H25N3O5/c1-23-16-3-2-12(24-7-6-20)9-13(16)19(5-4-16)10-11-8-14(21)18-15(22)17-11/h8,12-13,20H,2-7,9-10H2,1H3,(H2,17,18,21,22)/t12-,13-,16+/m0/s1 |
| InChIKey | YIEBDOZOOVROLC-HEHGZKQESA-N |
| XLogP | -0.42 |
| TPSA | 107.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.39 |
| LogP ≤ 5 | -0.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |