C16H23N3O4 — CID 119066080
[(3aR,6S,7aS)-6-(2-hydroxyethoxy)-3a-methoxy-3,4,5,6,7,7a-hexahydro-2H-indol-1-yl]-pyrimidin-5-ylmethanone (PubChem CID 119066080) has the molecular formula C16H23N3O4 and a molecular weight of 321.38 g/mol. Its IUPAC name is [(3aR,6S,7aS)-6-(2-hydroxyethoxy)-3a-methoxy-3,4,5,6,7,7a-hexahydro-2H-indol-1-yl]-pyrimidin-5-ylmethanone.
| Compound Name | [(3aR,6S,7aS)-6-(2-hydroxyethoxy)-3a-methoxy-3,4,5,6,7,7a-hexahydro-2H-indol-1-yl]-pyrimidin-5-ylmethanone |
|---|---|
| PubChem CID | 119066080 |
| Molecular Formula | C16H23N3O4 |
| Molecular Weight | 321.38 g/mol |
| Exact Mass | 321.17 |
| IUPAC Name | [(3aR,6S,7aS)-6-(2-hydroxyethoxy)-3a-methoxy-3,4,5,6,7,7a-hexahydro-2H-indol-1-yl]-pyrimidin-5-ylmethanone |
| SMILES | CO[C@@]12CC[C@H](OCCO)C[C@@H]1N(C(=O)c1cncnc1)CC2 |
| InChI | InChI=1S/C16H23N3O4/c1-22-16-3-2-13(23-7-6-20)8-14(16)19(5-4-16)15(21)12-9-17-11-18-10-12/h9-11,13-14,20H,2-8H2,1H3/t13-,14-,16+/m0/s1 |
| InChIKey | LTOFIWKWAAWPGT-OFQRWUPVSA-N |
| XLogP | 0.64 |
| TPSA | 84.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.38 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |