C20H29FN2O3 — CID 119067491
1-[(3aR,6R,7aS)-3a,6-dimethoxy-3,4,5,6,7,7a-hexahydro-2H-indol-1-yl]-2-[(4-fluorophenyl)methyl-methylamino]ethanone (PubChem CID 119067491) has the molecular formula C20H29FN2O3 and a molecular weight of 364.46 g/mol. Its IUPAC name is 1-[(3aR,6R,7aS)-3a,6-dimethoxy-3,4,5,6,7,7a-hexahydro-2H-indol-1-yl]-2-[(4-fluorophenyl)methyl-methylamino]ethanone.
| Compound Name | 1-[(3aR,6R,7aS)-3a,6-dimethoxy-3,4,5,6,7,7a-hexahydro-2H-indol-1-yl]-2-[(4-fluorophenyl)methyl-methylamino]ethanone |
|---|---|
| PubChem CID | 119067491 |
| Molecular Formula | C20H29FN2O3 |
| Molecular Weight | 364.46 g/mol |
| Exact Mass | 364.22 |
| IUPAC Name | 1-[(3aR,6R,7aS)-3a,6-dimethoxy-3,4,5,6,7,7a-hexahydro-2H-indol-1-yl]-2-[(4-fluorophenyl)methyl-methylamino]ethanone |
| SMILES | CO[C@@H]1CC[C@@]2(OC)CCN(C(=O)CN(C)Cc3ccc(F)cc3)[C@H]2C1 |
| InChI | InChI=1S/C20H29FN2O3/c1-22(13-15-4-6-16(21)7-5-15)14-19(24)23-11-10-20(26-3)9-8-17(25-2)12-18(20)23/h4-7,17-18H,8-14H2,1-3H3/t17-,18+,20-/m1/s1 |
| InChIKey | KIESFYZADRWCAK-WSTZPKSXSA-N |
| XLogP | 2.44 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.46 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |