C20H28FN3O2 — CID 110141655
(4aS,9aS)-1-[2-[(4-fluorophenyl)methyl-methylamino]acetyl]-4a-methyl-2,3,4,5,7,8,9,9a-octahydropyrido[3,2-b]azepin-6-one (PubChem CID 110141655) has the molecular formula C20H28FN3O2 and a molecular weight of 361.46 g/mol. Its IUPAC name is (4aS,9aS)-1-[2-[(4-fluorophenyl)methyl-methylamino]acetyl]-4a-methyl-2,3,4,5,7,8,9,9a-octahydropyrido[3,2-b]azepin-6-one.
| Compound Name | (4aS,9aS)-1-[2-[(4-fluorophenyl)methyl-methylamino]acetyl]-4a-methyl-2,3,4,5,7,8,9,9a-octahydropyrido[3,2-b]azepin-6-one |
|---|---|
| PubChem CID | 110141655 |
| Molecular Formula | C20H28FN3O2 |
| Molecular Weight | 361.46 g/mol |
| Exact Mass | 361.22 |
| IUPAC Name | (4aS,9aS)-1-[2-[(4-fluorophenyl)methyl-methylamino]acetyl]-4a-methyl-2,3,4,5,7,8,9,9a-octahydropyrido[3,2-b]azepin-6-one |
| SMILES | CN(CC(=O)N1CCC[C@]2(C)NC(=O)CCC[C@H]12)Cc1ccc(F)cc1 |
| InChI | InChI=1S/C20H28FN3O2/c1-20-11-4-12-24(17(20)5-3-6-18(25)22-20)19(26)14-23(2)13-15-7-9-16(21)10-8-15/h7-10,17H,3-6,11-14H2,1-2H3,(H,22,25)/t17-,20-/m0/s1 |
| InChIKey | WGKMEOOHLDPQRR-PXNSSMCTSA-N |
| XLogP | 2.31 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.46 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |