C19H23NO4 — CID 118789393
[(3aR,6R,7aS)-6-hydroxy-3a-methoxy-3,4,5,6,7,7a-hexahydro-2H-indol-1-yl]-(2-methyl-1-benzofuran-7-yl)methanone (PubChem CID 118789393) has the molecular formula C19H23NO4 and a molecular weight of 329.40 g/mol. Its IUPAC name is [(3aR,6R,7aS)-6-hydroxy-3a-methoxy-3,4,5,6,7,7a-hexahydro-2H-indol-1-yl]-(2-methyl-1-benzofuran-7-yl)methanone.
| Compound Name | [(3aR,6R,7aS)-6-hydroxy-3a-methoxy-3,4,5,6,7,7a-hexahydro-2H-indol-1-yl]-(2-methyl-1-benzofuran-7-yl)methanone |
|---|---|
| PubChem CID | 118789393 |
| Molecular Formula | C19H23NO4 |
| Molecular Weight | 329.40 g/mol |
| Exact Mass | 329.16 |
| IUPAC Name | [(3aR,6R,7aS)-6-hydroxy-3a-methoxy-3,4,5,6,7,7a-hexahydro-2H-indol-1-yl]-(2-methyl-1-benzofuran-7-yl)methanone |
| SMILES | CO[C@@]12CC[C@@H](O)C[C@@H]1N(C(=O)c1cccc3cc(C)oc13)CC2 |
| InChI | InChI=1S/C19H23NO4/c1-12-10-13-4-3-5-15(17(13)24-12)18(22)20-9-8-19(23-2)7-6-14(21)11-16(19)20/h3-5,10,14,16,21H,6-9,11H2,1-2H3/t14-,16+,19-/m1/s1 |
| InChIKey | WAGKIUVNLRPHHT-SIXWZSSISA-N |
| XLogP | 2.89 |
| TPSA | 62.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.40 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |