C18H21ClN2O3 — CID 118763025
[(3aR,6S,7aS)-6-hydroxy-3a-methoxy-3,4,5,6,7,7a-hexahydro-2H-indol-1-yl]-(3-chloro-1H-indol-2-yl)methanone (PubChem CID 118763025) has the molecular formula C18H21ClN2O3 and a molecular weight of 348.83 g/mol. Its IUPAC name is [(3aR,6S,7aS)-6-hydroxy-3a-methoxy-3,4,5,6,7,7a-hexahydro-2H-indol-1-yl]-(3-chloro-1H-indol-2-yl)methanone.
| Compound Name | [(3aR,6S,7aS)-6-hydroxy-3a-methoxy-3,4,5,6,7,7a-hexahydro-2H-indol-1-yl]-(3-chloro-1H-indol-2-yl)methanone |
|---|---|
| PubChem CID | 118763025 |
| Molecular Formula | C18H21ClN2O3 |
| Molecular Weight | 348.83 g/mol |
| Exact Mass | 348.12 |
| IUPAC Name | [(3aR,6S,7aS)-6-hydroxy-3a-methoxy-3,4,5,6,7,7a-hexahydro-2H-indol-1-yl]-(3-chloro-1H-indol-2-yl)methanone |
| SMILES | CO[C@@]12CC[C@H](O)C[C@@H]1N(C(=O)c1[nH]c3ccccc3c1Cl)CC2 |
| InChI | InChI=1S/C18H21ClN2O3/c1-24-18-7-6-11(22)10-14(18)21(9-8-18)17(23)16-15(19)12-4-2-3-5-13(12)20-16/h2-5,11,14,20,22H,6-10H2,1H3/t11-,14-,18+/m0/s1 |
| InChIKey | BONFXPDJEUKLRX-KQYVJACZSA-N |
| XLogP | 2.97 |
| TPSA | 65.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.83 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |