C21H23FN2O3 — CID 119059447
[(3aR,6R,7aS)-3a-methoxy-6-pyridin-2-yloxy-3,4,5,6,7,7a-hexahydro-2H-indol-1-yl]-(2-fluorophenyl)methanone (PubChem CID 119059447) has the molecular formula C21H23FN2O3 and a molecular weight of 370.42 g/mol. Its IUPAC name is [(3aR,6R,7aS)-3a-methoxy-6-pyridin-2-yloxy-3,4,5,6,7,7a-hexahydro-2H-indol-1-yl]-(2-fluorophenyl)methanone.
| Compound Name | [(3aR,6R,7aS)-3a-methoxy-6-pyridin-2-yloxy-3,4,5,6,7,7a-hexahydro-2H-indol-1-yl]-(2-fluorophenyl)methanone |
|---|---|
| PubChem CID | 119059447 |
| Molecular Formula | C21H23FN2O3 |
| Molecular Weight | 370.42 g/mol |
| Exact Mass | 370.17 |
| IUPAC Name | [(3aR,6R,7aS)-3a-methoxy-6-pyridin-2-yloxy-3,4,5,6,7,7a-hexahydro-2H-indol-1-yl]-(2-fluorophenyl)methanone |
| SMILES | CO[C@@]12CC[C@@H](Oc3ccccn3)C[C@@H]1N(C(=O)c1ccccc1F)CC2 |
| InChI | InChI=1S/C21H23FN2O3/c1-26-21-10-9-15(27-19-8-4-5-12-23-19)14-18(21)24(13-11-21)20(25)16-6-2-3-7-17(16)22/h2-8,12,15,18H,9-11,13-14H2,1H3/t15-,18+,21-/m1/s1 |
| InChIKey | WMQGLKBCGJDEGG-FYINFDKHSA-N |
| XLogP | 3.45 |
| TPSA | 51.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.42 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |