C23H30N2O4 — CID 119072940
(3aR,6S,7aS)-1-[(2,4-dimethoxyphenyl)methyl]-3a-methoxy-6-pyridin-2-yloxy-3,4,5,6,7,7a-hexahydro-2H-indole (PubChem CID 119072940) has the molecular formula C23H30N2O4 and a molecular weight of 398.50 g/mol. Its IUPAC name is (3aR,6S,7aS)-1-[(2,4-dimethoxyphenyl)methyl]-3a-methoxy-6-pyridin-2-yloxy-3,4,5,6,7,7a-hexahydro-2H-indole.
| Compound Name | (3aR,6S,7aS)-1-[(2,4-dimethoxyphenyl)methyl]-3a-methoxy-6-pyridin-2-yloxy-3,4,5,6,7,7a-hexahydro-2H-indole |
|---|---|
| PubChem CID | 119072940 |
| Molecular Formula | C23H30N2O4 |
| Molecular Weight | 398.50 g/mol |
| Exact Mass | 398.22 |
| IUPAC Name | (3aR,6S,7aS)-1-[(2,4-dimethoxyphenyl)methyl]-3a-methoxy-6-pyridin-2-yloxy-3,4,5,6,7,7a-hexahydro-2H-indole |
| SMILES | COc1ccc(CN2CC[C@]3(OC)CC[C@H](Oc4ccccn4)C[C@H]23)c(OC)c1 |
| InChI | InChI=1S/C23H30N2O4/c1-26-18-8-7-17(20(14-18)27-2)16-25-13-11-23(28-3)10-9-19(15-21(23)25)29-22-6-4-5-12-24-22/h4-8,12,14,19,21H,9-11,13,15-16H2,1-3H3/t19-,21-,23+/m0/s1 |
| InChIKey | ATZQWIQRVSCOTG-IEIRFRATSA-N |
| XLogP | 3.69 |
| TPSA | 53.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.50 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |