C24H27N3O2 — CID 119069219
5-[[(3aR,6S,7aS)-3a-methoxy-6-pyridin-2-yloxy-3,4,5,6,7,7a-hexahydro-2H-indol-1-yl]methyl]isoquinoline (PubChem CID 119069219) has the molecular formula C24H27N3O2 and a molecular weight of 389.50 g/mol. Its IUPAC name is 5-[[(3aR,6S,7aS)-3a-methoxy-6-pyridin-2-yloxy-3,4,5,6,7,7a-hexahydro-2H-indol-1-yl]methyl]isoquinoline.
| Compound Name | 5-[[(3aR,6S,7aS)-3a-methoxy-6-pyridin-2-yloxy-3,4,5,6,7,7a-hexahydro-2H-indol-1-yl]methyl]isoquinoline |
|---|---|
| PubChem CID | 119069219 |
| Molecular Formula | C24H27N3O2 |
| Molecular Weight | 389.50 g/mol |
| Exact Mass | 389.21 |
| IUPAC Name | 5-[[(3aR,6S,7aS)-3a-methoxy-6-pyridin-2-yloxy-3,4,5,6,7,7a-hexahydro-2H-indol-1-yl]methyl]isoquinoline |
| SMILES | CO[C@@]12CC[C@H](Oc3ccccn3)C[C@@H]1N(Cc1cccc3cnccc13)CC2 |
| InChI | InChI=1S/C24H27N3O2/c1-28-24-10-8-20(29-23-7-2-3-12-26-23)15-22(24)27(14-11-24)17-19-6-4-5-18-16-25-13-9-21(18)19/h2-7,9,12-13,16,20,22H,8,10-11,14-15,17H2,1H3/t20-,22-,24+/m0/s1 |
| InChIKey | ZUIPMWTWIBFWJW-ODGPQVTHSA-N |
| XLogP | 4.22 |
| TPSA | 47.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.50 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |