C22H28N2O3 — CID 119073155
(3aR,6S,7aS)-3a-methoxy-1-[(3-methoxyphenyl)methyl]-6-pyridin-2-yloxy-3,4,5,6,7,7a-hexahydro-2H-indole (PubChem CID 119073155) has the molecular formula C22H28N2O3 and a molecular weight of 368.48 g/mol. Its IUPAC name is (3aR,6S,7aS)-3a-methoxy-1-[(3-methoxyphenyl)methyl]-6-pyridin-2-yloxy-3,4,5,6,7,7a-hexahydro-2H-indole.
| Compound Name | (3aR,6S,7aS)-3a-methoxy-1-[(3-methoxyphenyl)methyl]-6-pyridin-2-yloxy-3,4,5,6,7,7a-hexahydro-2H-indole |
|---|---|
| PubChem CID | 119073155 |
| Molecular Formula | C22H28N2O3 |
| Molecular Weight | 368.48 g/mol |
| Exact Mass | 368.21 |
| IUPAC Name | (3aR,6S,7aS)-3a-methoxy-1-[(3-methoxyphenyl)methyl]-6-pyridin-2-yloxy-3,4,5,6,7,7a-hexahydro-2H-indole |
| SMILES | COc1cccc(CN2CC[C@]3(OC)CC[C@H](Oc4ccccn4)C[C@H]23)c1 |
| InChI | InChI=1S/C22H28N2O3/c1-25-18-7-5-6-17(14-18)16-24-13-11-22(26-2)10-9-19(15-20(22)24)27-21-8-3-4-12-23-21/h3-8,12,14,19-20H,9-11,13,15-16H2,1-2H3/t19-,20-,22+/m0/s1 |
| InChIKey | QMYBGKLEZQOXRI-JAXLGGSGSA-N |
| XLogP | 3.68 |
| TPSA | 43.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.48 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |