C20H28N4O2 — CID 119074171
(3aR,6S,7aS)-1-[(3-ethyl-1H-pyrazol-5-yl)methyl]-3a-methoxy-6-pyridin-2-yloxy-3,4,5,6,7,7a-hexahydro-2H-indole (PubChem CID 119074171) has the molecular formula C20H28N4O2 and a molecular weight of 356.47 g/mol. Its IUPAC name is (3aR,6S,7aS)-1-[(3-ethyl-1H-pyrazol-5-yl)methyl]-3a-methoxy-6-pyridin-2-yloxy-3,4,5,6,7,7a-hexahydro-2H-indole.
| Compound Name | (3aR,6S,7aS)-1-[(3-ethyl-1H-pyrazol-5-yl)methyl]-3a-methoxy-6-pyridin-2-yloxy-3,4,5,6,7,7a-hexahydro-2H-indole |
|---|---|
| PubChem CID | 119074171 |
| Molecular Formula | C20H28N4O2 |
| Molecular Weight | 356.47 g/mol |
| Exact Mass | 356.22 |
| IUPAC Name | (3aR,6S,7aS)-1-[(3-ethyl-1H-pyrazol-5-yl)methyl]-3a-methoxy-6-pyridin-2-yloxy-3,4,5,6,7,7a-hexahydro-2H-indole |
| SMILES | CCc1cc(CN2CC[C@]3(OC)CC[C@H](Oc4ccccn4)C[C@H]23)[nH]n1 |
| InChI | InChI=1S/C20H28N4O2/c1-3-15-12-16(23-22-15)14-24-11-9-20(25-2)8-7-17(13-18(20)24)26-19-6-4-5-10-21-19/h4-6,10,12,17-18H,3,7-9,11,13-14H2,1-2H3,(H,22,23)/t17-,18-,20+/m0/s1 |
| InChIKey | PUTHAYMAOQQAPY-CMKODMSKSA-N |
| XLogP | 2.96 |
| TPSA | 63.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.47 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |