C20H26N2O2 — CID 119069872
5-[[(3aR,6R,7aS)-3a,6-dimethoxy-3,4,5,6,7,7a-hexahydro-2H-indol-1-yl]methyl]isoquinoline (PubChem CID 119069872) has the molecular formula C20H26N2O2 and a molecular weight of 326.44 g/mol. Its IUPAC name is 5-[[(3aR,6R,7aS)-3a,6-dimethoxy-3,4,5,6,7,7a-hexahydro-2H-indol-1-yl]methyl]isoquinoline.
| Compound Name | 5-[[(3aR,6R,7aS)-3a,6-dimethoxy-3,4,5,6,7,7a-hexahydro-2H-indol-1-yl]methyl]isoquinoline |
|---|---|
| PubChem CID | 119069872 |
| Molecular Formula | C20H26N2O2 |
| Molecular Weight | 326.44 g/mol |
| Exact Mass | 326.20 |
| IUPAC Name | 5-[[(3aR,6R,7aS)-3a,6-dimethoxy-3,4,5,6,7,7a-hexahydro-2H-indol-1-yl]methyl]isoquinoline |
| SMILES | CO[C@@H]1CC[C@@]2(OC)CCN(Cc3cccc4cnccc34)[C@H]2C1 |
| InChI | InChI=1S/C20H26N2O2/c1-23-17-6-8-20(24-2)9-11-22(19(20)12-17)14-16-5-3-4-15-13-21-10-7-18(15)16/h3-5,7,10,13,17,19H,6,8-9,11-12,14H2,1-2H3/t17-,19+,20-/m1/s1 |
| InChIKey | NNZAIOFWRAVFGR-YZGWKJHDSA-N |
| XLogP | 3.39 |
| TPSA | 34.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.44 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |