C16H25NO2S — CID 118776007
(3aR,6R,7aS)-3a,6-dimethoxy-1-[(3-methylthiophen-2-yl)methyl]-3,4,5,6,7,7a-hexahydro-2H-indole (PubChem CID 118776007) has the molecular formula C16H25NO2S and a molecular weight of 295.45 g/mol. Its IUPAC name is (3aR,6R,7aS)-3a,6-dimethoxy-1-[(3-methylthiophen-2-yl)methyl]-3,4,5,6,7,7a-hexahydro-2H-indole.
| Compound Name | (3aR,6R,7aS)-3a,6-dimethoxy-1-[(3-methylthiophen-2-yl)methyl]-3,4,5,6,7,7a-hexahydro-2H-indole |
|---|---|
| PubChem CID | 118776007 |
| Molecular Formula | C16H25NO2S |
| Molecular Weight | 295.45 g/mol |
| Exact Mass | 295.16 |
| IUPAC Name | (3aR,6R,7aS)-3a,6-dimethoxy-1-[(3-methylthiophen-2-yl)methyl]-3,4,5,6,7,7a-hexahydro-2H-indole |
| SMILES | CO[C@@H]1CC[C@@]2(OC)CCN(Cc3sccc3C)[C@H]2C1 |
| InChI | InChI=1S/C16H25NO2S/c1-12-5-9-20-14(12)11-17-8-7-16(19-3)6-4-13(18-2)10-15(16)17/h5,9,13,15H,4,6-8,10-11H2,1-3H3/t13-,15+,16-/m1/s1 |
| InChIKey | VBNUNEAWAUOVDA-VNQPRFMTSA-N |
| XLogP | 3.21 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.45 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |