C19H25N3O3 — CID 118787487
2-[[(3aR,6S,7aS)-3a,6-dimethoxy-3,4,5,6,7,7a-hexahydro-2H-indol-1-yl]methyl]pyrido[1,2-a]pyrimidin-4-one (PubChem CID 118787487) has the molecular formula C19H25N3O3 and a molecular weight of 343.43 g/mol. Its IUPAC name is 2-[[(3aR,6S,7aS)-3a,6-dimethoxy-3,4,5,6,7,7a-hexahydro-2H-indol-1-yl]methyl]pyrido[1,2-a]pyrimidin-4-one.
| Compound Name | 2-[[(3aR,6S,7aS)-3a,6-dimethoxy-3,4,5,6,7,7a-hexahydro-2H-indol-1-yl]methyl]pyrido[1,2-a]pyrimidin-4-one |
|---|---|
| PubChem CID | 118787487 |
| Molecular Formula | C19H25N3O3 |
| Molecular Weight | 343.43 g/mol |
| Exact Mass | 343.19 |
| IUPAC Name | 2-[[(3aR,6S,7aS)-3a,6-dimethoxy-3,4,5,6,7,7a-hexahydro-2H-indol-1-yl]methyl]pyrido[1,2-a]pyrimidin-4-one |
| SMILES | CO[C@H]1CC[C@@]2(OC)CCN(Cc3cc(=O)n4ccccc4n3)[C@H]2C1 |
| InChI | InChI=1S/C19H25N3O3/c1-24-15-6-7-19(25-2)8-10-21(16(19)12-15)13-14-11-18(23)22-9-4-3-5-17(22)20-14/h3-5,9,11,15-16H,6-8,10,12-13H2,1-2H3/t15-,16-,19+/m0/s1 |
| InChIKey | WKAKZIDKSHDSGV-TXPKVOOTSA-N |
| XLogP | 1.85 |
| TPSA | 56.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.43 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |