C20H31NO5 — CID 119065770
(3aR,6R,7aS)-3a,6-dimethoxy-1-[(3,4,5-trimethoxyphenyl)methyl]-3,4,5,6,7,7a-hexahydro-2H-indole (PubChem CID 119065770) has the molecular formula C20H31NO5 and a molecular weight of 365.47 g/mol. Its IUPAC name is (3aR,6R,7aS)-3a,6-dimethoxy-1-[(3,4,5-trimethoxyphenyl)methyl]-3,4,5,6,7,7a-hexahydro-2H-indole.
| Compound Name | (3aR,6R,7aS)-3a,6-dimethoxy-1-[(3,4,5-trimethoxyphenyl)methyl]-3,4,5,6,7,7a-hexahydro-2H-indole |
|---|---|
| PubChem CID | 119065770 |
| Molecular Formula | C20H31NO5 |
| Molecular Weight | 365.47 g/mol |
| Exact Mass | 365.22 |
| IUPAC Name | (3aR,6R,7aS)-3a,6-dimethoxy-1-[(3,4,5-trimethoxyphenyl)methyl]-3,4,5,6,7,7a-hexahydro-2H-indole |
| SMILES | COc1cc(CN2CC[C@]3(OC)CC[C@@H](OC)C[C@H]23)cc(OC)c1OC |
| InChI | InChI=1S/C20H31NO5/c1-22-15-6-7-20(26-5)8-9-21(18(20)12-15)13-14-10-16(23-2)19(25-4)17(11-14)24-3/h10-11,15,18H,6-9,12-13H2,1-5H3/t15-,18+,20-/m1/s1 |
| InChIKey | LVXGCLBNXPHZHA-MOXGXCLJSA-N |
| XLogP | 2.87 |
| TPSA | 49.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.47 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |