C17H29N3O2 — CID 119069058
(3aR,6R,7aS)-3a,6-dimethoxy-1-[(1-propylimidazol-2-yl)methyl]-3,4,5,6,7,7a-hexahydro-2H-indole (PubChem CID 119069058) has the molecular formula C17H29N3O2 and a molecular weight of 307.44 g/mol. Its IUPAC name is (3aR,6R,7aS)-3a,6-dimethoxy-1-[(1-propylimidazol-2-yl)methyl]-3,4,5,6,7,7a-hexahydro-2H-indole.
| Compound Name | (3aR,6R,7aS)-3a,6-dimethoxy-1-[(1-propylimidazol-2-yl)methyl]-3,4,5,6,7,7a-hexahydro-2H-indole |
|---|---|
| PubChem CID | 119069058 |
| Molecular Formula | C17H29N3O2 |
| Molecular Weight | 307.44 g/mol |
| Exact Mass | 307.23 |
| IUPAC Name | (3aR,6R,7aS)-3a,6-dimethoxy-1-[(1-propylimidazol-2-yl)methyl]-3,4,5,6,7,7a-hexahydro-2H-indole |
| SMILES | CCCn1ccnc1CN1CC[C@]2(OC)CC[C@@H](OC)C[C@H]12 |
| InChI | InChI=1S/C17H29N3O2/c1-4-9-19-11-8-18-16(19)13-20-10-7-17(22-3)6-5-14(21-2)12-15(17)20/h8,11,14-15H,4-7,9-10,12-13H2,1-3H3/t14-,15+,17-/m1/s1 |
| InChIKey | YVCCQTWPFLVBNK-HLLBOEOZSA-N |
| XLogP | 2.45 |
| TPSA | 39.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.44 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |