C20H32N4O2 — CID 119060248
5-[[(3aR,6R,7aS)-6-(cyclopropylmethoxy)-3a-methoxy-3,4,5,6,7,7a-hexahydro-2H-indol-1-yl]methyl]-N-ethylpyrimidin-2-amine (PubChem CID 119060248) has the molecular formula C20H32N4O2 and a molecular weight of 360.50 g/mol. Its IUPAC name is 5-[[(3aR,6R,7aS)-6-(cyclopropylmethoxy)-3a-methoxy-3,4,5,6,7,7a-hexahydro-2H-indol-1-yl]methyl]-N-ethylpyrimidin-2-amine.
| Compound Name | 5-[[(3aR,6R,7aS)-6-(cyclopropylmethoxy)-3a-methoxy-3,4,5,6,7,7a-hexahydro-2H-indol-1-yl]methyl]-N-ethylpyrimidin-2-amine |
|---|---|
| PubChem CID | 119060248 |
| Molecular Formula | C20H32N4O2 |
| Molecular Weight | 360.50 g/mol |
| Exact Mass | 360.25 |
| IUPAC Name | 5-[[(3aR,6R,7aS)-6-(cyclopropylmethoxy)-3a-methoxy-3,4,5,6,7,7a-hexahydro-2H-indol-1-yl]methyl]-N-ethylpyrimidin-2-amine |
| SMILES | CCNc1ncc(CN2CC[C@]3(OC)CC[C@@H](OCC4CC4)C[C@H]23)cn1 |
| InChI | InChI=1S/C20H32N4O2/c1-3-21-19-22-11-16(12-23-19)13-24-9-8-20(25-2)7-6-17(10-18(20)24)26-14-15-4-5-15/h11-12,15,17-18H,3-10,13-14H2,1-2H3,(H,21,22,23)/t17-,18+,20-/m1/s1 |
| InChIKey | IWTLWQPSJPKQBT-WSTZPKSXSA-N |
| XLogP | 2.85 |
| TPSA | 59.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.50 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |