C19H29N3O2 — CID 156609607
6-(cyclopropylmethoxy)-1-(5,6-dimethylpyrimidin-4-yl)-3a-methoxy-3,4,5,6,7,7a-hexahydro-2H-indole (PubChem CID 156609607) has the molecular formula C19H29N3O2 and a molecular weight of 331.46 g/mol. Its IUPAC name is 6-(cyclopropylmethoxy)-1-(5,6-dimethylpyrimidin-4-yl)-3a-methoxy-3,4,5,6,7,7a-hexahydro-2H-indole.
| Compound Name | 6-(cyclopropylmethoxy)-1-(5,6-dimethylpyrimidin-4-yl)-3a-methoxy-3,4,5,6,7,7a-hexahydro-2H-indole |
|---|---|
| PubChem CID | 156609607 |
| Molecular Formula | C19H29N3O2 |
| Molecular Weight | 331.46 g/mol |
| Exact Mass | 331.23 |
| IUPAC Name | 6-(cyclopropylmethoxy)-1-(5,6-dimethylpyrimidin-4-yl)-3a-methoxy-3,4,5,6,7,7a-hexahydro-2H-indole |
| SMILES | COC12CCC(OCC3CC3)CC1N(c1ncnc(C)c1C)CC2 |
| InChI | InChI=1S/C19H29N3O2/c1-13-14(2)20-12-21-18(13)22-9-8-19(23-3)7-6-16(10-17(19)22)24-11-15-4-5-15/h12,15-17H,4-11H2,1-3H3 |
| InChIKey | AZLYGBBEJZJDTB-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 47.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.46 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |