C23H34N2O — CID 124824404
(1S,8aS)-1-cyclohexyl-2-[(E)-3-(2-methoxyphenyl)prop-2-enyl]-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine (PubChem CID 124824404) has the molecular formula C23H34N2O and a molecular weight of 354.54 g/mol. Its IUPAC name is (1S,8aS)-1-cyclohexyl-2-[(E)-3-(2-methoxyphenyl)prop-2-enyl]-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine.
| Compound Name | (1S,8aS)-1-cyclohexyl-2-[(E)-3-(2-methoxyphenyl)prop-2-enyl]-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine |
|---|---|
| PubChem CID | 124824404 |
| Molecular Formula | C23H34N2O |
| Molecular Weight | 354.54 g/mol |
| Exact Mass | 354.27 |
| IUPAC Name | (1S,8aS)-1-cyclohexyl-2-[(E)-3-(2-methoxyphenyl)prop-2-enyl]-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine |
| SMILES | COc1ccccc1/C=C/CN1CCN2CCC[C@H]2[C@@H]1C1CCCCC1 |
| InChI | InChI=1S/C23H34N2O/c1-26-22-14-6-5-9-19(22)12-7-16-25-18-17-24-15-8-13-21(24)23(25)20-10-3-2-4-11-20/h5-7,9,12,14,20-21,23H,2-4,8,10-11,13,15-18H2,1H3/b12-7+/t21-,23-/m0/s1 |
| InChIKey | KQOOYNSRNGDGAQ-LQUGGUCVSA-N |
| XLogP | 4.44 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.54 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |