C19H28N2O — CID 95707927
(2R)-1-[1-[(E)-3-(2-methoxyphenyl)prop-2-enyl]azetidin-3-yl]-2-methylpiperidine (PubChem CID 95707927) has the molecular formula C19H28N2O and a molecular weight of 300.45 g/mol. Its IUPAC name is (2R)-1-[1-[(E)-3-(2-methoxyphenyl)prop-2-enyl]azetidin-3-yl]-2-methylpiperidine.
| Compound Name | (2R)-1-[1-[(E)-3-(2-methoxyphenyl)prop-2-enyl]azetidin-3-yl]-2-methylpiperidine |
|---|---|
| PubChem CID | 95707927 |
| Molecular Formula | C19H28N2O |
| Molecular Weight | 300.45 g/mol |
| Exact Mass | 300.22 |
| IUPAC Name | (2R)-1-[1-[(E)-3-(2-methoxyphenyl)prop-2-enyl]azetidin-3-yl]-2-methylpiperidine |
| SMILES | COc1ccccc1/C=C/CN1CC(N2CCCC[C@H]2C)C1 |
| InChI | InChI=1S/C19H28N2O/c1-16-8-5-6-13-21(16)18-14-20(15-18)12-7-10-17-9-3-4-11-19(17)22-2/h3-4,7,9-11,16,18H,5-6,8,12-15H2,1-2H3/b10-7+/t16-/m1/s1 |
| InChIKey | CPPZMAHGBWDCRC-OJXHRBAXSA-N |
| XLogP | 3.27 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.45 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |