C18H26N2O — CID 92603759
(3R,8aR)-2-[(E)-3-(2-methoxyphenyl)prop-2-enyl]-3-methyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine (PubChem CID 92603759) has the molecular formula C18H26N2O and a molecular weight of 286.42 g/mol. Its IUPAC name is (3R,8aR)-2-[(E)-3-(2-methoxyphenyl)prop-2-enyl]-3-methyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine.
| Compound Name | (3R,8aR)-2-[(E)-3-(2-methoxyphenyl)prop-2-enyl]-3-methyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine |
|---|---|
| PubChem CID | 92603759 |
| Molecular Formula | C18H26N2O |
| Molecular Weight | 286.42 g/mol |
| Exact Mass | 286.20 |
| IUPAC Name | (3R,8aR)-2-[(E)-3-(2-methoxyphenyl)prop-2-enyl]-3-methyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine |
| SMILES | COc1ccccc1/C=C/CN1C[C@H]2CCCN2C[C@H]1C |
| InChI | InChI=1S/C18H26N2O/c1-15-13-20-12-6-9-17(20)14-19(15)11-5-8-16-7-3-4-10-18(16)21-2/h3-5,7-8,10,15,17H,6,9,11-14H2,1-2H3/b8-5+/t15-,17-/m1/s1 |
| InChIKey | GSCZTLGLYFMIST-XNHCWWPPSA-N |
| XLogP | 2.88 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.42 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |