C21H31BrN2O — CID 124755214
(1S,8aS)-2-[(5-bromo-2-methoxyphenyl)methyl]-1-cyclohexyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine (PubChem CID 124755214) has the molecular formula C21H31BrN2O and a molecular weight of 407.40 g/mol. Its IUPAC name is (1S,8aS)-2-[(5-bromo-2-methoxyphenyl)methyl]-1-cyclohexyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine.
| Compound Name | (1S,8aS)-2-[(5-bromo-2-methoxyphenyl)methyl]-1-cyclohexyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine |
|---|---|
| PubChem CID | 124755214 |
| Molecular Formula | C21H31BrN2O |
| Molecular Weight | 407.40 g/mol |
| Exact Mass | 406.16 |
| IUPAC Name | (1S,8aS)-2-[(5-bromo-2-methoxyphenyl)methyl]-1-cyclohexyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine |
| SMILES | COc1ccc(Br)cc1CN1CCN2CCC[C@H]2[C@@H]1C1CCCCC1 |
| InChI | InChI=1S/C21H31BrN2O/c1-25-20-10-9-18(22)14-17(20)15-24-13-12-23-11-5-8-19(23)21(24)16-6-3-2-4-7-16/h9-10,14,16,19,21H,2-8,11-13,15H2,1H3/t19-,21-/m0/s1 |
| InChIKey | PVWSCJXHSRLQEG-FPOVZHCZSA-N |
| XLogP | 4.69 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.40 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |