C19H29BrN2O — CID 1333767
1-[(5-bromo-2-methoxyphenyl)methyl]-4-[(3R)-3-methylpiperidin-1-yl]piperidine (PubChem CID 1333767) has the molecular formula C19H29BrN2O and a molecular weight of 381.36 g/mol. Its IUPAC name is 1-[(5-bromo-2-methoxyphenyl)methyl]-4-[(3R)-3-methylpiperidin-1-yl]piperidine.
| Compound Name | 1-[(5-bromo-2-methoxyphenyl)methyl]-4-[(3R)-3-methylpiperidin-1-yl]piperidine |
|---|---|
| PubChem CID | 1333767 |
| Molecular Formula | C19H29BrN2O |
| Molecular Weight | 381.36 g/mol |
| Exact Mass | 380.15 |
| IUPAC Name | 1-[(5-bromo-2-methoxyphenyl)methyl]-4-[(3R)-3-methylpiperidin-1-yl]piperidine |
| SMILES | COc1ccc(Br)cc1CN1CCC(N2CCC[C@@H](C)C2)CC1 |
| InChI | InChI=1S/C19H29BrN2O/c1-15-4-3-9-22(13-15)18-7-10-21(11-8-18)14-16-12-17(20)5-6-19(16)23-2/h5-6,12,15,18H,3-4,7-11,13-14H2,1-2H3/t15-/m1/s1 |
| InChIKey | PVVZIKSNMTWZHQ-OAHLLOKOSA-N |
| XLogP | 4.15 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.36 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |