C15H22BrNOS — CID 114237822
1-[(5-bromo-2-methoxyphenyl)methyl]-4-methylsulfanylazepane (PubChem CID 114237822) has the molecular formula C15H22BrNOS and a molecular weight of 344.32 g/mol. Its IUPAC name is 1-[(5-bromo-2-methoxyphenyl)methyl]-4-methylsulfanylazepane.
| Compound Name | 1-[(5-bromo-2-methoxyphenyl)methyl]-4-methylsulfanylazepane |
|---|---|
| PubChem CID | 114237822 |
| Molecular Formula | C15H22BrNOS |
| Molecular Weight | 344.32 g/mol |
| Exact Mass | 343.06 |
| IUPAC Name | 1-[(5-bromo-2-methoxyphenyl)methyl]-4-methylsulfanylazepane |
| SMILES | COc1ccc(Br)cc1CN1CCCC(SC)CC1 |
| InChI | InChI=1S/C15H22BrNOS/c1-18-15-6-5-13(16)10-12(15)11-17-8-3-4-14(19-2)7-9-17/h5-6,10,14H,3-4,7-9,11H2,1-2H3 |
| InChIKey | YNPBLYIIZOCQAF-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.32 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |