C16H24N2O3 — CID 118791136
(3aR,6S,7aS)-3a-methoxy-1-[(3-methoxy-2-pyridinyl)methyl]-3,4,5,6,7,7a-hexahydro-2H-indol-6-ol (PubChem CID 118791136) has the molecular formula C16H24N2O3 and a molecular weight of 292.38 g/mol. Its IUPAC name is (3aR,6S,7aS)-3a-methoxy-1-[(3-methoxy-2-pyridinyl)methyl]-3,4,5,6,7,7a-hexahydro-2H-indol-6-ol.
| Compound Name | (3aR,6S,7aS)-3a-methoxy-1-[(3-methoxy-2-pyridinyl)methyl]-3,4,5,6,7,7a-hexahydro-2H-indol-6-ol |
|---|---|
| PubChem CID | 118791136 |
| Molecular Formula | C16H24N2O3 |
| Molecular Weight | 292.38 g/mol |
| Exact Mass | 292.18 |
| IUPAC Name | (3aR,6S,7aS)-3a-methoxy-1-[(3-methoxy-2-pyridinyl)methyl]-3,4,5,6,7,7a-hexahydro-2H-indol-6-ol |
| SMILES | COc1cccnc1CN1CC[C@]2(OC)CC[C@H](O)C[C@H]12 |
| InChI | InChI=1S/C16H24N2O3/c1-20-14-4-3-8-17-13(14)11-18-9-7-16(21-2)6-5-12(19)10-15(16)18/h3-4,8,12,15,19H,5-7,9-11H2,1-2H3/t12-,15-,16+/m0/s1 |
| InChIKey | OJSLMVSIRZYMNT-VBNZEHGJSA-N |
| XLogP | 1.59 |
| TPSA | 54.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.38 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |