C13H21N5O — CID 124752545
[(9aS)-8-methyl-3,4,6,7,9,9a-hexahydro-1H-pyrazino[1,2-a]pyrazin-2-yl]-(5-methyl-1H-imidazol-2-yl)methanone (PubChem CID 124752545) has the molecular formula C13H21N5O and a molecular weight of 263.34 g/mol. Its IUPAC name is [(9aS)-8-methyl-3,4,6,7,9,9a-hexahydro-1H-pyrazino[1,2-a]pyrazin-2-yl]-(5-methyl-1H-imidazol-2-yl)methanone.
| Compound Name | [(9aS)-8-methyl-3,4,6,7,9,9a-hexahydro-1H-pyrazino[1,2-a]pyrazin-2-yl]-(5-methyl-1H-imidazol-2-yl)methanone |
|---|---|
| PubChem CID | 124752545 |
| Molecular Formula | C13H21N5O |
| Molecular Weight | 263.34 g/mol |
| Exact Mass | 263.17 |
| IUPAC Name | [(9aS)-8-methyl-3,4,6,7,9,9a-hexahydro-1H-pyrazino[1,2-a]pyrazin-2-yl]-(5-methyl-1H-imidazol-2-yl)methanone |
| SMILES | Cc1cnc(C(=O)N2CCN3CCN(C)C[C@H]3C2)[nH]1 |
| InChI | InChI=1S/C13H21N5O/c1-10-7-14-12(15-10)13(19)18-6-5-17-4-3-16(2)8-11(17)9-18/h7,11H,3-6,8-9H2,1-2H3,(H,14,15)/t11-/m0/s1 |
| InChIKey | JVXFKNRVNLTGBG-NSHDSACASA-N |
| XLogP | -0.21 |
| TPSA | 55.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.34 |
| LogP ≤ 5 | -0.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |