C18H24N4O — CID 50958229
(8-methyl-3,4,6,7,9,9a-hexahydro-1H-pyrazino[1,2-a]pyrazin-2-yl)-(5-methyl-1H-indol-2-yl)methanone (PubChem CID 50958229) has the molecular formula C18H24N4O and a molecular weight of 312.42 g/mol. Its IUPAC name is (8-methyl-3,4,6,7,9,9a-hexahydro-1H-pyrazino[1,2-a]pyrazin-2-yl)-(5-methyl-1H-indol-2-yl)methanone.
| Compound Name | (8-methyl-3,4,6,7,9,9a-hexahydro-1H-pyrazino[1,2-a]pyrazin-2-yl)-(5-methyl-1H-indol-2-yl)methanone |
|---|---|
| PubChem CID | 50958229 |
| Molecular Formula | C18H24N4O |
| Molecular Weight | 312.42 g/mol |
| Exact Mass | 312.20 |
| IUPAC Name | (8-methyl-3,4,6,7,9,9a-hexahydro-1H-pyrazino[1,2-a]pyrazin-2-yl)-(5-methyl-1H-indol-2-yl)methanone |
| SMILES | Cc1ccc2[nH]c(C(=O)N3CCN4CCN(C)CC4C3)cc2c1 |
| InChI | InChI=1S/C18H24N4O/c1-13-3-4-16-14(9-13)10-17(19-16)18(23)22-8-7-21-6-5-20(2)11-15(21)12-22/h3-4,9-10,15,19H,5-8,11-12H2,1-2H3 |
| InChIKey | WHXSTLFVOVWPRM-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 42.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.42 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |