C21H27FN4O3 — CID 42239803
ethyl 4-[(3R)-1-(5-fluoro-1H-indole-2-carbonyl)piperidin-3-yl]piperazine-1-carboxylate (PubChem CID 42239803) has the molecular formula C21H27FN4O3 and a molecular weight of 402.47 g/mol. Its IUPAC name is ethyl 4-[(3R)-1-(5-fluoro-1H-indole-2-carbonyl)piperidin-3-yl]piperazine-1-carboxylate.
| Compound Name | ethyl 4-[(3R)-1-(5-fluoro-1H-indole-2-carbonyl)piperidin-3-yl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 42239803 |
| Molecular Formula | C21H27FN4O3 |
| Molecular Weight | 402.47 g/mol |
| Exact Mass | 402.21 |
| IUPAC Name | ethyl 4-[(3R)-1-(5-fluoro-1H-indole-2-carbonyl)piperidin-3-yl]piperazine-1-carboxylate |
| SMILES | CCOC(=O)N1CCN([C@@H]2CCCN(C(=O)c3cc4cc(F)ccc4[nH]3)C2)CC1 |
| InChI | InChI=1S/C21H27FN4O3/c1-2-29-21(28)25-10-8-24(9-11-25)17-4-3-7-26(14-17)20(27)19-13-15-12-16(22)5-6-18(15)23-19/h5-6,12-13,17,23H,2-4,7-11,14H2,1H3/t17-/m1/s1 |
| InChIKey | HEKRIJMGGPLBEH-QGZVFWFLSA-N |
| XLogP | 2.69 |
| TPSA | 68.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.47 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |