C17H25N3O3S — CID 42286032
ethyl 4-[(3R)-1-(thiophene-3-carbonyl)piperidin-3-yl]piperazine-1-carboxylate (PubChem CID 42286032) has the molecular formula C17H25N3O3S and a molecular weight of 351.47 g/mol. Its IUPAC name is ethyl 4-[(3R)-1-(thiophene-3-carbonyl)piperidin-3-yl]piperazine-1-carboxylate.
| Compound Name | ethyl 4-[(3R)-1-(thiophene-3-carbonyl)piperidin-3-yl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 42286032 |
| Molecular Formula | C17H25N3O3S |
| Molecular Weight | 351.47 g/mol |
| Exact Mass | 351.16 |
| IUPAC Name | ethyl 4-[(3R)-1-(thiophene-3-carbonyl)piperidin-3-yl]piperazine-1-carboxylate |
| SMILES | CCOC(=O)N1CCN([C@@H]2CCCN(C(=O)c3ccsc3)C2)CC1 |
| InChI | InChI=1S/C17H25N3O3S/c1-2-23-17(22)19-9-7-18(8-10-19)15-4-3-6-20(12-15)16(21)14-5-11-24-13-14/h5,11,13,15H,2-4,6-10,12H2,1H3/t15-/m1/s1 |
| InChIKey | CULAGTKVARYRHR-OAHLLOKOSA-N |
| XLogP | 2.13 |
| TPSA | 53.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.47 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |