C16H23N3O3S — CID 134078691
9-ethyl-2-(thiophene-3-carbonyl)-1,3,4,6,7,8,10,10a-octahydropyrazino[1,2-a][1,4]diazepine-7-carboxylic acid (PubChem CID 134078691) has the molecular formula C16H23N3O3S and a molecular weight of 337.45 g/mol. Its IUPAC name is 9-ethyl-2-(thiophene-3-carbonyl)-1,3,4,6,7,8,10,10a-octahydropyrazino[1,2-a][1,4]diazepine-7-carboxylic acid.
| Compound Name | 9-ethyl-2-(thiophene-3-carbonyl)-1,3,4,6,7,8,10,10a-octahydropyrazino[1,2-a][1,4]diazepine-7-carboxylic acid |
|---|---|
| PubChem CID | 134078691 |
| Molecular Formula | C16H23N3O3S |
| Molecular Weight | 337.45 g/mol |
| Exact Mass | 337.15 |
| IUPAC Name | 9-ethyl-2-(thiophene-3-carbonyl)-1,3,4,6,7,8,10,10a-octahydropyrazino[1,2-a][1,4]diazepine-7-carboxylic acid |
| SMILES | CCN1CC(C(=O)O)CN2CCN(C(=O)c3ccsc3)CC2C1 |
| InChI | InChI=1S/C16H23N3O3S/c1-2-17-7-13(16(21)22)8-18-4-5-19(10-14(18)9-17)15(20)12-3-6-23-11-12/h3,6,11,13-14H,2,4-5,7-10H2,1H3,(H,21,22) |
| InChIKey | YUMYCRXKVNJGDK-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 64.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.45 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |