C18H27N3O5 — CID 45185738
ethyl 4-[1-(5-methoxyfuran-2-carbonyl)piperidin-3-yl]piperazine-1-carboxylate (PubChem CID 45185738) has the molecular formula C18H27N3O5 and a molecular weight of 365.43 g/mol. Its IUPAC name is ethyl 4-[1-(5-methoxyfuran-2-carbonyl)piperidin-3-yl]piperazine-1-carboxylate.
| Compound Name | ethyl 4-[1-(5-methoxyfuran-2-carbonyl)piperidin-3-yl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 45185738 |
| Molecular Formula | C18H27N3O5 |
| Molecular Weight | 365.43 g/mol |
| Exact Mass | 365.20 |
| IUPAC Name | ethyl 4-[1-(5-methoxyfuran-2-carbonyl)piperidin-3-yl]piperazine-1-carboxylate |
| SMILES | CCOC(=O)N1CCN(C2CCCN(C(=O)c3ccc(OC)o3)C2)CC1 |
| InChI | InChI=1S/C18H27N3O5/c1-3-25-18(23)20-11-9-19(10-12-20)14-5-4-8-21(13-14)17(22)15-6-7-16(24-2)26-15/h6-7,14H,3-5,8-13H2,1-2H3 |
| InChIKey | OUFARRXWPACBJU-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 75.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.43 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |