C22H35N5O3 — CID 45170473
ethyl 4-[1-(5-cyclohexyl-1H-pyrazole-4-carbonyl)piperidin-3-yl]piperazine-1-carboxylate (PubChem CID 45170473) has the molecular formula C22H35N5O3 and a molecular weight of 417.55 g/mol. Its IUPAC name is ethyl 4-[1-(5-cyclohexyl-1H-pyrazole-4-carbonyl)piperidin-3-yl]piperazine-1-carboxylate.
| Compound Name | ethyl 4-[1-(5-cyclohexyl-1H-pyrazole-4-carbonyl)piperidin-3-yl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 45170473 |
| Molecular Formula | C22H35N5O3 |
| Molecular Weight | 417.55 g/mol |
| Exact Mass | 417.27 |
| IUPAC Name | ethyl 4-[1-(5-cyclohexyl-1H-pyrazole-4-carbonyl)piperidin-3-yl]piperazine-1-carboxylate |
| SMILES | CCOC(=O)N1CCN(C2CCCN(C(=O)c3cn[nH]c3C3CCCCC3)C2)CC1 |
| InChI | InChI=1S/C22H35N5O3/c1-2-30-22(29)26-13-11-25(12-14-26)18-9-6-10-27(16-18)21(28)19-15-23-24-20(19)17-7-4-3-5-8-17/h15,17-18H,2-14,16H2,1H3,(H,23,24) |
| InChIKey | HQXVFCUVIYURRC-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 81.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.55 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |