C22H27N3O3 — CID 72844387
3-[1-(5-cyclohexyl-1H-pyrazole-4-carbonyl)piperidin-3-yl]benzoic acid (PubChem CID 72844387) has the molecular formula C22H27N3O3 and a molecular weight of 381.48 g/mol. Its IUPAC name is 3-[1-(5-cyclohexyl-1H-pyrazole-4-carbonyl)piperidin-3-yl]benzoic acid.
| Compound Name | 3-[1-(5-cyclohexyl-1H-pyrazole-4-carbonyl)piperidin-3-yl]benzoic acid |
|---|---|
| PubChem CID | 72844387 |
| Molecular Formula | C22H27N3O3 |
| Molecular Weight | 381.48 g/mol |
| Exact Mass | 381.21 |
| IUPAC Name | 3-[1-(5-cyclohexyl-1H-pyrazole-4-carbonyl)piperidin-3-yl]benzoic acid |
| SMILES | O=C(O)c1cccc(C2CCCN(C(=O)c3cn[nH]c3C3CCCCC3)C2)c1 |
| InChI | InChI=1S/C22H27N3O3/c26-21(19-13-23-24-20(19)15-6-2-1-3-7-15)25-11-5-10-18(14-25)16-8-4-9-17(12-16)22(27)28/h4,8-9,12-13,15,18H,1-3,5-7,10-11,14H2,(H,23,24)(H,27,28) |
| InChIKey | GHLNGHNHFRBNLB-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 86.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.48 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |