C18H21N3O — CID 70732469
(5-cyclohexyl-1H-pyrazol-4-yl)-(1,3-dihydroisoindol-2-yl)methanone (PubChem CID 70732469) has the molecular formula C18H21N3O and a molecular weight of 295.39 g/mol. Its IUPAC name is (5-cyclohexyl-1H-pyrazol-4-yl)-(1,3-dihydroisoindol-2-yl)methanone.
| Compound Name | (5-cyclohexyl-1H-pyrazol-4-yl)-(1,3-dihydroisoindol-2-yl)methanone |
|---|---|
| PubChem CID | 70732469 |
| Molecular Formula | C18H21N3O |
| Molecular Weight | 295.39 g/mol |
| Exact Mass | 295.17 |
| IUPAC Name | (5-cyclohexyl-1H-pyrazol-4-yl)-(1,3-dihydroisoindol-2-yl)methanone |
| SMILES | O=C(c1cn[nH]c1C1CCCCC1)N1Cc2ccccc2C1 |
| InChI | InChI=1S/C18H21N3O/c22-18(21-11-14-8-4-5-9-15(14)12-21)16-10-19-20-17(16)13-6-2-1-3-7-13/h4-5,8-10,13H,1-3,6-7,11-12H2,(H,19,20) |
| InChIKey | YOJBACLDFIUNJZ-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 48.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.39 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |