C16H24N4O3 — CID 70755411
methyl 4-(5-cyclohexyl-1H-pyrazole-4-carbonyl)piperazine-1-carboxylate (PubChem CID 70755411) has the molecular formula C16H24N4O3 and a molecular weight of 320.39 g/mol. Its IUPAC name is methyl 4-(5-cyclohexyl-1H-pyrazole-4-carbonyl)piperazine-1-carboxylate.
| Compound Name | methyl 4-(5-cyclohexyl-1H-pyrazole-4-carbonyl)piperazine-1-carboxylate |
|---|---|
| PubChem CID | 70755411 |
| Molecular Formula | C16H24N4O3 |
| Molecular Weight | 320.39 g/mol |
| Exact Mass | 320.18 |
| IUPAC Name | methyl 4-(5-cyclohexyl-1H-pyrazole-4-carbonyl)piperazine-1-carboxylate |
| SMILES | COC(=O)N1CCN(C(=O)c2cn[nH]c2C2CCCCC2)CC1 |
| InChI | InChI=1S/C16H24N4O3/c1-23-16(22)20-9-7-19(8-10-20)15(21)13-11-17-18-14(13)12-5-3-2-4-6-12/h11-12H,2-10H2,1H3,(H,17,18) |
| InChIKey | GUUDXVJAHOPCRH-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 78.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.39 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |