C23H32N4O2 — CID 110082926
azepan-1-yl-[5-[1-[(3-methoxyphenyl)methyl]piperidin-4-yl]-1H-pyrazol-4-yl]methanone (PubChem CID 110082926) has the molecular formula C23H32N4O2 and a molecular weight of 396.54 g/mol. Its IUPAC name is azepan-1-yl-[5-[1-[(3-methoxyphenyl)methyl]piperidin-4-yl]-1H-pyrazol-4-yl]methanone.
| Compound Name | azepan-1-yl-[5-[1-[(3-methoxyphenyl)methyl]piperidin-4-yl]-1H-pyrazol-4-yl]methanone |
|---|---|
| PubChem CID | 110082926 |
| Molecular Formula | C23H32N4O2 |
| Molecular Weight | 396.54 g/mol |
| Exact Mass | 396.25 |
| IUPAC Name | azepan-1-yl-[5-[1-[(3-methoxyphenyl)methyl]piperidin-4-yl]-1H-pyrazol-4-yl]methanone |
| SMILES | COc1cccc(CN2CCC(c3[nH]ncc3C(=O)N3CCCCCC3)CC2)c1 |
| InChI | InChI=1S/C23H32N4O2/c1-29-20-8-6-7-18(15-20)17-26-13-9-19(10-14-26)22-21(16-24-25-22)23(28)27-11-4-2-3-5-12-27/h6-8,15-16,19H,2-5,9-14,17H2,1H3,(H,24,25) |
| InChIKey | HIDDQLRJONUZER-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 61.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.54 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |