C25H36N4O3 — CID 110083019
azepan-1-yl-[5-[1-[[3-(2-methoxyethoxy)phenyl]methyl]piperidin-3-yl]-1H-pyrazol-4-yl]methanone (PubChem CID 110083019) has the molecular formula C25H36N4O3 and a molecular weight of 440.59 g/mol. Its IUPAC name is azepan-1-yl-[5-[1-[[3-(2-methoxyethoxy)phenyl]methyl]piperidin-3-yl]-1H-pyrazol-4-yl]methanone.
| Compound Name | azepan-1-yl-[5-[1-[[3-(2-methoxyethoxy)phenyl]methyl]piperidin-3-yl]-1H-pyrazol-4-yl]methanone |
|---|---|
| PubChem CID | 110083019 |
| Molecular Formula | C25H36N4O3 |
| Molecular Weight | 440.59 g/mol |
| Exact Mass | 440.28 |
| IUPAC Name | azepan-1-yl-[5-[1-[[3-(2-methoxyethoxy)phenyl]methyl]piperidin-3-yl]-1H-pyrazol-4-yl]methanone |
| SMILES | COCCOc1cccc(CN2CCCC(c3[nH]ncc3C(=O)N3CCCCCC3)C2)c1 |
| InChI | InChI=1S/C25H36N4O3/c1-31-14-15-32-22-10-6-8-20(16-22)18-28-11-7-9-21(19-28)24-23(17-26-27-24)25(30)29-12-4-2-3-5-13-29/h6,8,10,16-17,21H,2-5,7,9,11-15,18-19H2,1H3,(H,26,27) |
| InChIKey | BESXGFYTMAEACI-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 70.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.59 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|