C19H27N5O2 — CID 75474473
1-ethyl-3-[5-[1-[(3-methoxyphenyl)methyl]piperidin-3-yl]-1H-pyrazol-4-yl]urea (PubChem CID 75474473) has the molecular formula C19H27N5O2 and a molecular weight of 357.46 g/mol. Its IUPAC name is 1-ethyl-3-[5-[1-[(3-methoxyphenyl)methyl]piperidin-3-yl]-1H-pyrazol-4-yl]urea.
| Compound Name | 1-ethyl-3-[5-[1-[(3-methoxyphenyl)methyl]piperidin-3-yl]-1H-pyrazol-4-yl]urea |
|---|---|
| PubChem CID | 75474473 |
| Molecular Formula | C19H27N5O2 |
| Molecular Weight | 357.46 g/mol |
| Exact Mass | 357.22 |
| IUPAC Name | 1-ethyl-3-[5-[1-[(3-methoxyphenyl)methyl]piperidin-3-yl]-1H-pyrazol-4-yl]urea |
| SMILES | CCNC(=O)Nc1cn[nH]c1C1CCCN(Cc2cccc(OC)c2)C1 |
| InChI | InChI=1S/C19H27N5O2/c1-3-20-19(25)22-17-11-21-23-18(17)15-7-5-9-24(13-15)12-14-6-4-8-16(10-14)26-2/h4,6,8,10-11,15H,3,5,7,9,12-13H2,1-2H3,(H,21,23)(H2,20,22,25) |
| InChIKey | RBUUCKZIVRAMNV-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 82.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.46 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |