C15H27N5O3S — CID 97344690
1-[5-[(3R)-1-butylsulfonylpiperidin-3-yl]-1H-pyrazol-4-yl]-3-ethylurea (PubChem CID 97344690) has the molecular formula C15H27N5O3S and a molecular weight of 357.48 g/mol. Its IUPAC name is 1-[5-[(3R)-1-butylsulfonylpiperidin-3-yl]-1H-pyrazol-4-yl]-3-ethylurea.
| Compound Name | 1-[5-[(3R)-1-butylsulfonylpiperidin-3-yl]-1H-pyrazol-4-yl]-3-ethylurea |
|---|---|
| PubChem CID | 97344690 |
| Molecular Formula | C15H27N5O3S |
| Molecular Weight | 357.48 g/mol |
| Exact Mass | 357.18 |
| IUPAC Name | 1-[5-[(3R)-1-butylsulfonylpiperidin-3-yl]-1H-pyrazol-4-yl]-3-ethylurea |
| SMILES | CCCCS(=O)(=O)N1CCC[C@@H](c2[nH]ncc2NC(=O)NCC)C1 |
| InChI | InChI=1S/C15H27N5O3S/c1-3-5-9-24(22,23)20-8-6-7-12(11-20)14-13(10-17-19-14)18-15(21)16-4-2/h10,12H,3-9,11H2,1-2H3,(H,17,19)(H2,16,18,21)/t12-/m1/s1 |
| InChIKey | VFRQHVYPUYAFOG-GFCCVEGCSA-N |
| XLogP | 1.86 |
| TPSA | 107.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.48 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |