C18H27NO3 — CID 4016440
1-[[3-(3-methylbutoxy)phenyl]methyl]piperidine-3-carboxylic acid (PubChem CID 4016440) has the molecular formula C18H27NO3 and a molecular weight of 305.42 g/mol. Its IUPAC name is 1-[[3-(3-methylbutoxy)phenyl]methyl]piperidine-3-carboxylic acid.
| Compound Name | 1-[[3-(3-methylbutoxy)phenyl]methyl]piperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 4016440 |
| Molecular Formula | C18H27NO3 |
| Molecular Weight | 305.42 g/mol |
| Exact Mass | 305.20 |
| IUPAC Name | 1-[[3-(3-methylbutoxy)phenyl]methyl]piperidine-3-carboxylic acid |
| SMILES | CC(C)CCOc1cccc(CN2CCCC(C(=O)O)C2)c1 |
| InChI | InChI=1S/C18H27NO3/c1-14(2)8-10-22-17-7-3-5-15(11-17)12-19-9-4-6-16(13-19)18(20)21/h3,5,7,11,14,16H,4,6,8-10,12-13H2,1-2H3,(H,20,21) |
| InChIKey | MEGATNFIKYCBHG-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.42 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |