C20H33N3O2 — CID 54848441
1-[(3-heptoxyphenyl)methyl]piperidine-3-carbohydrazide (PubChem CID 54848441) has the molecular formula C20H33N3O2 and a molecular weight of 347.50 g/mol. Its IUPAC name is 1-[(3-heptoxyphenyl)methyl]piperidine-3-carbohydrazide.
| Compound Name | 1-[(3-heptoxyphenyl)methyl]piperidine-3-carbohydrazide |
|---|---|
| PubChem CID | 54848441 |
| Molecular Formula | C20H33N3O2 |
| Molecular Weight | 347.50 g/mol |
| Exact Mass | 347.26 |
| IUPAC Name | 1-[(3-heptoxyphenyl)methyl]piperidine-3-carbohydrazide |
| SMILES | CCCCCCCOc1cccc(CN2CCCC(C(=O)NN)C2)c1 |
| InChI | InChI=1S/C20H33N3O2/c1-2-3-4-5-6-13-25-19-11-7-9-17(14-19)15-23-12-8-10-18(16-23)20(24)22-21/h7,9,11,14,18H,2-6,8,10,12-13,15-16,21H2,1H3,(H,22,24) |
| InChIKey | DIEFWOPRAQFHSN-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.50 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|