C19H22N4O3 — CID 72856458
3-[1-[2-(ethylamino)pyrimidine-5-carbonyl]piperidin-3-yl]benzoic acid (PubChem CID 72856458) has the molecular formula C19H22N4O3 and a molecular weight of 354.41 g/mol. Its IUPAC name is 3-[1-[2-(ethylamino)pyrimidine-5-carbonyl]piperidin-3-yl]benzoic acid.
| Compound Name | 3-[1-[2-(ethylamino)pyrimidine-5-carbonyl]piperidin-3-yl]benzoic acid |
|---|---|
| PubChem CID | 72856458 |
| Molecular Formula | C19H22N4O3 |
| Molecular Weight | 354.41 g/mol |
| Exact Mass | 354.17 |
| IUPAC Name | 3-[1-[2-(ethylamino)pyrimidine-5-carbonyl]piperidin-3-yl]benzoic acid |
| SMILES | CCNc1ncc(C(=O)N2CCCC(c3cccc(C(=O)O)c3)C2)cn1 |
| InChI | InChI=1S/C19H22N4O3/c1-2-20-19-21-10-16(11-22-19)17(24)23-8-4-7-15(12-23)13-5-3-6-14(9-13)18(25)26/h3,5-6,9-11,15H,2,4,7-8,12H2,1H3,(H,25,26)(H,20,21,22) |
| InChIKey | VETHRBWPHJBQHZ-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 95.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.41 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |