C24H23N3O3 — CID 72896375
3-[1-(2-methyl-4-phenylpyrimidine-5-carbonyl)piperidin-3-yl]benzoic acid (PubChem CID 72896375) has the molecular formula C24H23N3O3 and a molecular weight of 401.47 g/mol. Its IUPAC name is 3-[1-(2-methyl-4-phenylpyrimidine-5-carbonyl)piperidin-3-yl]benzoic acid.
| Compound Name | 3-[1-(2-methyl-4-phenylpyrimidine-5-carbonyl)piperidin-3-yl]benzoic acid |
|---|---|
| PubChem CID | 72896375 |
| Molecular Formula | C24H23N3O3 |
| Molecular Weight | 401.47 g/mol |
| Exact Mass | 401.17 |
| IUPAC Name | 3-[1-(2-methyl-4-phenylpyrimidine-5-carbonyl)piperidin-3-yl]benzoic acid |
| SMILES | Cc1ncc(C(=O)N2CCCC(c3cccc(C(=O)O)c3)C2)c(-c2ccccc2)n1 |
| InChI | InChI=1S/C24H23N3O3/c1-16-25-14-21(22(26-16)17-7-3-2-4-8-17)23(28)27-12-6-11-20(15-27)18-9-5-10-19(13-18)24(29)30/h2-5,7-10,13-14,20H,6,11-12,15H2,1H3,(H,29,30) |
| InChIKey | FJQQZHFMONYJCP-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 83.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.47 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |