C14H17N3OS — CID 95297967
[(3R)-3-(4-methylpyrazol-1-yl)piperidin-1-yl]-thiophen-3-ylmethanone (PubChem CID 95297967) has the molecular formula C14H17N3OS and a molecular weight of 275.38 g/mol. Its IUPAC name is [(3R)-3-(4-methylpyrazol-1-yl)piperidin-1-yl]-thiophen-3-ylmethanone.
| Compound Name | [(3R)-3-(4-methylpyrazol-1-yl)piperidin-1-yl]-thiophen-3-ylmethanone |
|---|---|
| PubChem CID | 95297967 |
| Molecular Formula | C14H17N3OS |
| Molecular Weight | 275.38 g/mol |
| Exact Mass | 275.11 |
| IUPAC Name | [(3R)-3-(4-methylpyrazol-1-yl)piperidin-1-yl]-thiophen-3-ylmethanone |
| SMILES | Cc1cnn([C@@H]2CCCN(C(=O)c3ccsc3)C2)c1 |
| InChI | InChI=1S/C14H17N3OS/c1-11-7-15-17(8-11)13-3-2-5-16(9-13)14(18)12-4-6-19-10-12/h4,6-8,10,13H,2-3,5,9H2,1H3/t13-/m1/s1 |
| InChIKey | JHOLKZPFHPXJDT-CYBMUJFWSA-N |
| XLogP | 2.73 |
| TPSA | 38.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.38 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |