C17H21N3O3S — CID 95382966
[(3S)-3-(4-methylpyrazol-1-yl)piperidin-1-yl]-(3-methylsulfonylphenyl)methanone (PubChem CID 95382966) has the molecular formula C17H21N3O3S and a molecular weight of 347.44 g/mol. Its IUPAC name is [(3S)-3-(4-methylpyrazol-1-yl)piperidin-1-yl]-(3-methylsulfonylphenyl)methanone.
| Compound Name | [(3S)-3-(4-methylpyrazol-1-yl)piperidin-1-yl]-(3-methylsulfonylphenyl)methanone |
|---|---|
| PubChem CID | 95382966 |
| Molecular Formula | C17H21N3O3S |
| Molecular Weight | 347.44 g/mol |
| Exact Mass | 347.13 |
| IUPAC Name | [(3S)-3-(4-methylpyrazol-1-yl)piperidin-1-yl]-(3-methylsulfonylphenyl)methanone |
| SMILES | Cc1cnn([C@H]2CCCN(C(=O)c3cccc(S(C)(=O)=O)c3)C2)c1 |
| InChI | InChI=1S/C17H21N3O3S/c1-13-10-18-20(11-13)15-6-4-8-19(12-15)17(21)14-5-3-7-16(9-14)24(2,22)23/h3,5,7,9-11,15H,4,6,8,12H2,1-2H3/t15-/m0/s1 |
| InChIKey | XOAXRJQSJIJTRE-HNNXBMFYSA-N |
| XLogP | 2.07 |
| TPSA | 72.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.44 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |