C14H18BrNO3S — CID 80661180
[3-(bromomethyl)piperidin-1-yl]-(3-methylsulfonylphenyl)methanone (PubChem CID 80661180) has the molecular formula C14H18BrNO3S and a molecular weight of 360.27 g/mol. Its IUPAC name is [3-(bromomethyl)piperidin-1-yl]-(3-methylsulfonylphenyl)methanone.
| Compound Name | [3-(bromomethyl)piperidin-1-yl]-(3-methylsulfonylphenyl)methanone |
|---|---|
| PubChem CID | 80661180 |
| Molecular Formula | C14H18BrNO3S |
| Molecular Weight | 360.27 g/mol |
| Exact Mass | 359.02 |
| IUPAC Name | [3-(bromomethyl)piperidin-1-yl]-(3-methylsulfonylphenyl)methanone |
| SMILES | CS(=O)(=O)c1cccc(C(=O)N2CCCC(CBr)C2)c1 |
| InChI | InChI=1S/C14H18BrNO3S/c1-20(18,19)13-6-2-5-12(8-13)14(17)16-7-3-4-11(9-15)10-16/h2,5-6,8,11H,3-4,7,9-10H2,1H3 |
| InChIKey | REEUWPVCVOODDQ-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.27 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|