C15H20BrNO3S — CID 80669234
[3-(2-bromoethyl)piperidin-1-yl]-(4-methylsulfonylphenyl)methanone (PubChem CID 80669234) has the molecular formula C15H20BrNO3S and a molecular weight of 374.30 g/mol. Its IUPAC name is [3-(2-bromoethyl)piperidin-1-yl]-(4-methylsulfonylphenyl)methanone.
| Compound Name | [3-(2-bromoethyl)piperidin-1-yl]-(4-methylsulfonylphenyl)methanone |
|---|---|
| PubChem CID | 80669234 |
| Molecular Formula | C15H20BrNO3S |
| Molecular Weight | 374.30 g/mol |
| Exact Mass | 373.03 |
| IUPAC Name | [3-(2-bromoethyl)piperidin-1-yl]-(4-methylsulfonylphenyl)methanone |
| SMILES | CS(=O)(=O)c1ccc(C(=O)N2CCCC(CCBr)C2)cc1 |
| InChI | InChI=1S/C15H20BrNO3S/c1-21(19,20)14-6-4-13(5-7-14)15(18)17-10-2-3-12(11-17)8-9-16/h4-7,12H,2-3,8-11H2,1H3 |
| InChIKey | VWBONAMSJZNXMC-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.30 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|