C13H18BrN3O3 — CID 80670170
[3-(2-bromoethyl)piperidin-1-yl]-(1-methyl-5-nitropyrrol-2-yl)methanone (PubChem CID 80670170) has the molecular formula C13H18BrN3O3 and a molecular weight of 344.21 g/mol. Its IUPAC name is [3-(2-bromoethyl)piperidin-1-yl]-(1-methyl-5-nitropyrrol-2-yl)methanone.
| Compound Name | [3-(2-bromoethyl)piperidin-1-yl]-(1-methyl-5-nitropyrrol-2-yl)methanone |
|---|---|
| PubChem CID | 80670170 |
| Molecular Formula | C13H18BrN3O3 |
| Molecular Weight | 344.21 g/mol |
| Exact Mass | 343.05 |
| IUPAC Name | [3-(2-bromoethyl)piperidin-1-yl]-(1-methyl-5-nitropyrrol-2-yl)methanone |
| SMILES | Cn1c(C(=O)N2CCCC(CCBr)C2)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C13H18BrN3O3/c1-15-11(4-5-12(15)17(19)20)13(18)16-8-2-3-10(9-16)6-7-14/h4-5,10H,2-3,6-9H2,1H3 |
| InChIKey | JIVFNWBTCTWIOE-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 68.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.21 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|