C19H29NO4S — CID 174158092
tert-butyl (3S)-3-[2-(4-methylsulfonylphenyl)ethyl]piperidine-1-carboxylate (PubChem CID 174158092) has the molecular formula C19H29NO4S and a molecular weight of 367.51 g/mol. Its IUPAC name is tert-butyl (3S)-3-[2-(4-methylsulfonylphenyl)ethyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl (3S)-3-[2-(4-methylsulfonylphenyl)ethyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 174158092 |
| Molecular Formula | C19H29NO4S |
| Molecular Weight | 367.51 g/mol |
| Exact Mass | 367.18 |
| IUPAC Name | tert-butyl (3S)-3-[2-(4-methylsulfonylphenyl)ethyl]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC[C@H](CCc2ccc(S(C)(=O)=O)cc2)C1 |
| InChI | InChI=1S/C19H29NO4S/c1-19(2,3)24-18(21)20-13-5-6-16(14-20)8-7-15-9-11-17(12-10-15)25(4,22)23/h9-12,16H,5-8,13-14H2,1-4H3/t16-/m1/s1 |
| InChIKey | FJBFNVFEKSMULM-MRXNPFEDSA-N |
| XLogP | 3.67 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.51 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |